C10H19ClN2O4S — CID 114466410
ethyl N-[[1-(chloromethyl)cyclohexyl]sulfamoyl]carbamate (PubChem CID 114466410) has the molecular formula C10H19ClN2O4S and a molecular weight of 298.79 g/mol. Its IUPAC name is ethyl N-[[1-(chloromethyl)cyclohexyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[1-(chloromethyl)cyclohexyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114466410 |
| Molecular Formula | C10H19ClN2O4S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl N-[[1-(chloromethyl)cyclohexyl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NC1(CCl)CCCCC1 |
| InChI | InChI=1S/C10H19ClN2O4S/c1-2-17-9(14)12-18(15,16)13-10(8-11)6-4-3-5-7-10/h13H,2-8H2,1H3,(H,12,14) |
| InChIKey | ZARBUQNLIJWRML-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|