C11H22N2O5S — CID 114464188
ethyl N-[[1-(hydroxymethyl)-4-methylcyclohexyl]sulfamoyl]carbamate (PubChem CID 114464188) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is ethyl N-[[1-(hydroxymethyl)-4-methylcyclohexyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[1-(hydroxymethyl)-4-methylcyclohexyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464188 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | ethyl N-[[1-(hydroxymethyl)-4-methylcyclohexyl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NC1(CO)CCC(C)CC1 |
| InChI | InChI=1S/C11H22N2O5S/c1-3-18-10(15)12-19(16,17)13-11(8-14)6-4-9(2)5-7-11/h9,13-14H,3-8H2,1-2H3,(H,12,15) |
| InChIKey | IDDUAGQEAWXBKD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |