C12H23NO3S — CID 64987572
1-cyclopropyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]methanesulfonamide (PubChem CID 64987572) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-cyclopropyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]methanesulfonamide.
| Compound Name | 1-cyclopropyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 64987572 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-cyclopropyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]methanesulfonamide |
| SMILES | CC1CCC(CO)(NS(=O)(=O)CC2CC2)CC1 |
| InChI | InChI=1S/C12H23NO3S/c1-10-4-6-12(9-14,7-5-10)13-17(15,16)8-11-2-3-11/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | IOEBXRWTYUXRIS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |