C10H21NO3S — CID 62526005
N-[1-(hydroxymethyl)-4-methylcyclohexyl]ethanesulfonamide (PubChem CID 62526005) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)-4-methylcyclohexyl]ethanesulfonamide.
| Compound Name | N-[1-(hydroxymethyl)-4-methylcyclohexyl]ethanesulfonamide |
|---|---|
| PubChem CID | 62526005 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[1-(hydroxymethyl)-4-methylcyclohexyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1(CO)CCC(C)CC1 |
| InChI | InChI=1S/C10H21NO3S/c1-3-15(13,14)11-10(8-12)6-4-9(2)5-7-10/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | KMXIEDBKDIEIHD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |