C14H28N2O3S — CID 62526694
N-[1-(hydroxymethyl)-4-methylcyclohexyl]azepane-1-sulfonamide (PubChem CID 62526694) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)-4-methylcyclohexyl]azepane-1-sulfonamide.
| Compound Name | N-[1-(hydroxymethyl)-4-methylcyclohexyl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 62526694 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[1-(hydroxymethyl)-4-methylcyclohexyl]azepane-1-sulfonamide |
| SMILES | CC1CCC(CO)(NS(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C14H28N2O3S/c1-13-6-8-14(12-17,9-7-13)15-20(18,19)16-10-4-2-3-5-11-16/h13,15,17H,2-12H2,1H3 |
| InChIKey | JDZDOBBYNFPVOJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |