About 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea
1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea (PubChem CID 79161293) has the molecular formula C11H22N4O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea.
Molecular Properties
| Compound Name | 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea |
| PubChem CID | 79161293 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea |
| SMILES | CCN(CC)C(=O)NC1(C(N)=NO)CCCC1 |
| InChI | InChI=1S/C11H22N4O2/c1-3-15(4-2)10(16)13-11(9(12)14-17)7-5-6-8-11/h17H,3-8H2,1-2H3,(H2,12,14)(H,13,16) |
| InChIKey | CMZMSHRPJXYTKY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea?
The IUPAC name of 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea (CID 79161293) is 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea.
What is the SMILES notation for 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea?
The canonical SMILES for 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea is CCN(CC)C(=O)NC1(C(N)=NO)CCCC1.
What is the InChIKey of 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea?
The InChIKey is CMZMSHRPJXYTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O2/c1-3-15(4-2)10(16)13-11(9(12)14-17)7-5-6-8-11/h17H,3-8H2,1-2H3,(H2,12,14)(H,13,16).
What are the key properties of 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea?
1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea has a molecular weight of 242.32 g/mol, XLogP of 1.10, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethyl-3-[1-(N'-hydroxycarbamimidoyl)cyclopentyl]urea is sourced from PubChem (CID 79161293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).