C14H27N3OS — CID 79162159
3-(1-carbamothioylcyclooctyl)-1,1-diethylurea (PubChem CID 79162159) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is 3-(1-carbamothioylcyclooctyl)-1,1-diethylurea.
| Compound Name | 3-(1-carbamothioylcyclooctyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79162159 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 3-(1-carbamothioylcyclooctyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1(C(N)=S)CCCCCCC1 |
| InChI | InChI=1S/C14H27N3OS/c1-3-17(4-2)13(18)16-14(12(15)19)10-8-6-5-7-9-11-14/h3-11H2,1-2H3,(H2,15,19)(H,16,18) |
| InChIKey | USXCUTLRYGCOTO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|