C12H23N3OS — CID 79154076
3-(1-carbamothioylcyclooctyl)-1,1-dimethylurea (PubChem CID 79154076) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 3-(1-carbamothioylcyclooctyl)-1,1-dimethylurea.
| Compound Name | 3-(1-carbamothioylcyclooctyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154076 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-(1-carbamothioylcyclooctyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1(C(N)=S)CCCCCCC1 |
| InChI | InChI=1S/C12H23N3OS/c1-15(2)11(16)14-12(10(13)17)8-6-4-3-5-7-9-12/h3-9H2,1-2H3,(H2,13,17)(H,14,16) |
| InChIKey | APKDDJIUMRWROV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|