C9H15N3O2S — CID 43547628
N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 43547628) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43547628 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | Cc1n[nH]c(C)c1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15N3O2S/c1-6-9(7(2)12-11-6)10-8-3-4-15(13,14)5-8/h8,10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | PCLJTARHKYKFJL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |