C11H13N3O8S2 — CID 4059509
N-(4-methylsulfonyl-2,6-dinitrophenyl)-1,1-dioxothiolan-3-amine (PubChem CID 4059509) has the molecular formula C11H13N3O8S2 and a molecular weight of 379.37 g/mol. Its IUPAC name is N-(4-methylsulfonyl-2,6-dinitrophenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(4-methylsulfonyl-2,6-dinitrophenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 4059509 |
| Molecular Formula | C11H13N3O8S2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-(4-methylsulfonyl-2,6-dinitrophenyl)-1,1-dioxothiolan-3-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NC2CCS(=O)(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O8S2/c1-23(19,20)8-4-9(13(15)16)11(10(5-8)14(17)18)12-7-2-3-24(21,22)6-7/h4-5,7,12H,2-3,6H2,1H3 |
| InChIKey | CSHGFEBGRMYYHG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 166.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|