C14H19N3O7S2 — CID 40588367
N-[(3S)-1,1-dioxothiolan-3-yl]-4-morpholin-4-yl-3-nitrobenzenesulfonamide (PubChem CID 40588367) has the molecular formula C14H19N3O7S2 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-morpholin-4-yl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-morpholin-4-yl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 40588367 |
| Molecular Formula | C14H19N3O7S2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-morpholin-4-yl-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N[C@H]2CCS(=O)(=O)C2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C14H19N3O7S2/c18-17(19)14-9-12(1-2-13(14)16-4-6-24-7-5-16)26(22,23)15-11-3-8-25(20,21)10-11/h1-2,9,11,15H,3-8,10H2/t11-/m0/s1 |
| InChIKey | HMEYJFANUXGYHK-NSHDSACASA-N |
| XLogP | -0.10 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|