C16H23NO5S2 — CID 110300905
4-cyclopentyloxy-N-(1,1-dioxothiolan-3-yl)-2-methylbenzenesulfonamide (PubChem CID 110300905) has the molecular formula C16H23NO5S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-(1,1-dioxothiolan-3-yl)-2-methylbenzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-N-(1,1-dioxothiolan-3-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110300905 |
| Molecular Formula | C16H23NO5S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-cyclopentyloxy-N-(1,1-dioxothiolan-3-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(OC2CCCC2)ccc1S(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23NO5S2/c1-12-10-15(22-14-4-2-3-5-14)6-7-16(12)24(20,21)17-13-8-9-23(18,19)11-13/h6-7,10,13-14,17H,2-5,8-9,11H2,1H3 |
| InChIKey | MJAHITDGDSOPEX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |