C10H11BrFNO2S — CID 107633424
N-(2-bromo-5-fluorophenyl)-1,1-dioxothiolan-3-amine (PubChem CID 107633424) has the molecular formula C10H11BrFNO2S and a molecular weight of 308.17 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2-bromo-5-fluorophenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 107633424 |
| Molecular Formula | C10H11BrFNO2S |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(Nc2cc(F)ccc2Br)C1 |
| InChI | InChI=1S/C10H11BrFNO2S/c11-9-2-1-7(12)5-10(9)13-8-3-4-16(14,15)6-8/h1-2,5,8,13H,3-4,6H2 |
| InChIKey | HUKQKZLIIMKMTL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |