methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate

C12H14FNO4S — CID 63162524

IUPACmethyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate
SMILESCOC(=O)c1ccc(F)cc1NC1CCS(=O)(=O)C1
InChIInChI=1S/C12H14FNO4S/c1-18-12(15)10-3-2-8(13)6-11(10)14-9-4-5-19(16,17)7-9/h2-3,6,9,14H,4-5,7H2,1H3
InChIKeyGEPQTMROQVZYQT-UHFFFAOYSA-N
MW287.31 g/mol
LogP1.21
Rot. Bonds3

About methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate

methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate (PubChem CID 63162524) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate.

Molecular Properties

Compound Namemethyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate
PubChem CID63162524
Molecular FormulaC12H14FNO4S
Molecular Weight287.31 g/mol
Exact Mass287.06
IUPAC Namemethyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate
SMILESCOC(=O)c1ccc(F)cc1NC1CCS(=O)(=O)C1
InChIInChI=1S/C12H14FNO4S/c1-18-12(15)10-3-2-8(13)6-11(10)14-9-4-5-19(16,17)7-9/h2-3,6,9,14H,4-5,7H2,1H3
InChIKeyGEPQTMROQVZYQT-UHFFFAOYSA-N
XLogP1.21
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.31
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate?
The IUPAC name of methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate (CID 63162524) is methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate.
What is the SMILES notation for methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate?
The canonical SMILES for methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate is COC(=O)c1ccc(F)cc1NC1CCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate?
The InChIKey is GEPQTMROQVZYQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO4S/c1-18-12(15)10-3-2-8(13)6-11(10)14-9-4-5-19(16,17)7-9/h2-3,6,9,14H,4-5,7H2,1H3.
What are the key properties of methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate?
methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate has a molecular weight of 287.31 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate is sourced from PubChem (CID 63162524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).