C12H14FNO4S — CID 63162524
methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate (PubChem CID 63162524) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate.
| Compound Name | methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 63162524 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | methyl 2-[(1,1-dioxothiolan-3-yl)amino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)cc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14FNO4S/c1-18-12(15)10-3-2-8(13)6-11(10)14-9-4-5-19(16,17)7-9/h2-3,6,9,14H,4-5,7H2,1H3 |
| InChIKey | GEPQTMROQVZYQT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |