C13H16FNO4S — CID 43715483
methyl 5-[(1,1-dioxothian-4-yl)amino]-2-fluorobenzoate (PubChem CID 43715483) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 5-[(1,1-dioxothian-4-yl)amino]-2-fluorobenzoate.
| Compound Name | methyl 5-[(1,1-dioxothian-4-yl)amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 43715483 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl 5-[(1,1-dioxothian-4-yl)amino]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(NC2CCS(=O)(=O)CC2)ccc1F |
| InChI | InChI=1S/C13H16FNO4S/c1-19-13(16)11-8-10(2-3-12(11)14)15-9-4-6-20(17,18)7-5-9/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | NALDTNDHMPRCAB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |