4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid

C13H17NO4S — CID 81282018

IUPAC4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid
SMILESCc1cc(NC2CCS(=O)(=O)CC2)ccc1C(=O)O
InChIInChI=1S/C13H17NO4S/c1-9-8-11(2-3-12(9)13(15)16)14-10-4-6-19(17,18)7-5-10/h2-3,8,10,14H,4-7H2,1H3,(H,15,16)
InChIKeyBEHKOSYJDKGCAF-UHFFFAOYSA-N
MW283.35 g/mol
LogP1.68
Rot. Bonds3

About 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid

4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid (PubChem CID 81282018) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid
PubChem CID81282018
Molecular FormulaC13H17NO4S
Molecular Weight283.35 g/mol
Exact Mass283.09
IUPAC Name4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid
SMILESCc1cc(NC2CCS(=O)(=O)CC2)ccc1C(=O)O
InChIInChI=1S/C13H17NO4S/c1-9-8-11(2-3-12(9)13(15)16)14-10-4-6-19(17,18)7-5-10/h2-3,8,10,14H,4-7H2,1H3,(H,15,16)
InChIKeyBEHKOSYJDKGCAF-UHFFFAOYSA-N
XLogP1.68
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.35
LogP ≤ 51.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-[(1,1-dioxothian-3-yl)amino]-2-methylbenzoic acid
CID 81282203
2-methyl-4-[(3-methylcyclopentyl)amino]benzoic acid
CID 114541219
2-methyl-4-(oxolan-3-ylamino)benzoic acid
CID 81281891
4-[(3,4-dimethylcyclohexyl)amino]-2-methylbenzoic acid
CID 81282708
5-(cyclohexylamino)-2-methylbenzoic acid
CID 82932718
1-[4-(cyclohexylamino)-2-methylphenyl]ethanone
CID 20716281
methyl 5-[(1,1-dioxothian-4-yl)amino]-2-fluorobenzoate
CID 43715483
4-[(3-ethylsulfanylcyclopentyl)amino]-2-methylbenzoic acid
CID 114123569
4-[(1,1-dioxothian-4-yl)amino]-6-methylpyridine-3-carboxylic acid
CID 81233400
4-[(2-ethylcyclohexyl)amino]-2-methylbenzoic acid
CID 81281868
2-methyl-4-[(2-phenylcyclopropyl)amino]benzoic acid
CID 81281627
N-[4-[(1,1-dioxothian-4-yl)amino]phenyl]cyclopropanecarboxamide
CID 43511624

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid?
The IUPAC name of 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid (CID 81282018) is 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid.
What is the SMILES notation for 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid?
The canonical SMILES for 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid is Cc1cc(NC2CCS(=O)(=O)CC2)ccc1C(=O)O.
What is the InChIKey of 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid?
The InChIKey is BEHKOSYJDKGCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4S/c1-9-8-11(2-3-12(9)13(15)16)14-10-4-6-19(17,18)7-5-10/h2-3,8,10,14H,4-7H2,1H3,(H,15,16).
What are the key properties of 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid?
4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid has a molecular weight of 283.35 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothian-4-yl)amino]-2-methylbenzoic acid is sourced from PubChem (CID 81282018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).