C15H20N2O3S — CID 43511624
N-[4-[(1,1-dioxothian-4-yl)amino]phenyl]cyclopropanecarboxamide (PubChem CID 43511624) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[4-[(1,1-dioxothian-4-yl)amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(1,1-dioxothian-4-yl)amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43511624 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[4-[(1,1-dioxothian-4-yl)amino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)CC2)cc1)C1CC1 |
| InChI | InChI=1S/C15H20N2O3S/c18-15(11-1-2-11)17-13-5-3-12(4-6-13)16-14-7-9-21(19,20)10-8-14/h3-6,11,14,16H,1-2,7-10H2,(H,17,18) |
| InChIKey | XYBZTQYKWRCATI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |