C15H22N2O3S — CID 43720805
2-[4-[(1,1-dioxothian-4-yl)amino]phenyl]-N,N-dimethylacetamide (PubChem CID 43720805) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxothian-4-yl)amino]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(1,1-dioxothian-4-yl)amino]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43720805 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[4-[(1,1-dioxothian-4-yl)amino]phenyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccc(NC2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-17(2)15(18)11-12-3-5-13(6-4-12)16-14-7-9-21(19,20)10-8-14/h3-6,14,16H,7-11H2,1-2H3 |
| InChIKey | VOJGYFMWRAQFRI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |