C13H15F2NO4S — CID 79834485
methyl 4-[(1,1-dioxothian-4-yl)amino]-2,3-difluorobenzoate (PubChem CID 79834485) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is methyl 4-[(1,1-dioxothian-4-yl)amino]-2,3-difluorobenzoate.
| Compound Name | methyl 4-[(1,1-dioxothian-4-yl)amino]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 79834485 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | methyl 4-[(1,1-dioxothian-4-yl)amino]-2,3-difluorobenzoate |
| SMILES | COC(=O)c1ccc(NC2CCS(=O)(=O)CC2)c(F)c1F |
| InChI | InChI=1S/C13H15F2NO4S/c1-20-13(17)9-2-3-10(12(15)11(9)14)16-8-4-6-21(18,19)7-5-8/h2-3,8,16H,4-7H2,1H3 |
| InChIKey | ZEOKQZBESPZHBM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |