methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate

C13H15F2NO3 — CID 82729164

IUPACmethyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate
SMILESCOC(=O)c1ccc(NC2CCOC2C)c(F)c1F
InChIInChI=1S/C13H15F2NO3/c1-7-9(5-6-19-7)16-10-4-3-8(13(17)18-2)11(14)12(10)15/h3-4,7,9,16H,5-6H2,1-2H3
InChIKeySLHARAMMRPOJHK-UHFFFAOYSA-N
MW271.26 g/mol
LogP2.34
Rot. Bonds3

About methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate

methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate (PubChem CID 82729164) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate.

Molecular Properties

Compound Namemethyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate
PubChem CID82729164
Molecular FormulaC13H15F2NO3
Molecular Weight271.26 g/mol
Exact Mass271.10
IUPAC Namemethyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate
SMILESCOC(=O)c1ccc(NC2CCOC2C)c(F)c1F
InChIInChI=1S/C13H15F2NO3/c1-7-9(5-6-19-7)16-10-4-3-8(13(17)18-2)11(14)12(10)15/h3-4,7,9,16H,5-6H2,1-2H3
InChIKeySLHARAMMRPOJHK-UHFFFAOYSA-N
XLogP2.34
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.26
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate?
The IUPAC name of methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate (CID 82729164) is methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate.
What is the SMILES notation for methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate?
The canonical SMILES for methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate is COC(=O)c1ccc(NC2CCOC2C)c(F)c1F.
What is the InChIKey of methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate?
The InChIKey is SLHARAMMRPOJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO3/c1-7-9(5-6-19-7)16-10-4-3-8(13(17)18-2)11(14)12(10)15/h3-4,7,9,16H,5-6H2,1-2H3.
What are the key properties of methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate?
methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate has a molecular weight of 271.26 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-difluoro-4-[(2-methyloxolan-3-yl)amino]benzoate is sourced from PubChem (CID 82729164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).