C12H14F2N2O2 — CID 82727285
2,4-difluoro-5-[(2-methyloxolan-3-yl)amino]benzamide (PubChem CID 82727285) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2,4-difluoro-5-[(2-methyloxolan-3-yl)amino]benzamide.
| Compound Name | 2,4-difluoro-5-[(2-methyloxolan-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 82727285 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2,4-difluoro-5-[(2-methyloxolan-3-yl)amino]benzamide |
| SMILES | CC1OCCC1Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O2/c1-6-10(2-3-18-6)16-11-4-7(12(15)17)8(13)5-9(11)14/h4-6,10,16H,2-3H2,1H3,(H2,15,17) |
| InChIKey | NUKWRSAFLMQHNP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |