C12H14F2N2OS — CID 79941342
2,4-difluoro-5-[(5-methylthiolan-3-yl)amino]benzamide (PubChem CID 79941342) has the molecular formula C12H14F2N2OS and a molecular weight of 272.32 g/mol. Its IUPAC name is 2,4-difluoro-5-[(5-methylthiolan-3-yl)amino]benzamide.
| Compound Name | 2,4-difluoro-5-[(5-methylthiolan-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 79941342 |
| Molecular Formula | C12H14F2N2OS |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,4-difluoro-5-[(5-methylthiolan-3-yl)amino]benzamide |
| SMILES | CC1CC(Nc2cc(C(N)=O)c(F)cc2F)CS1 |
| InChI | InChI=1S/C12H14F2N2OS/c1-6-2-7(5-18-6)16-11-3-8(12(15)17)9(13)4-10(11)14/h3-4,6-7,16H,2,5H2,1H3,(H2,15,17) |
| InChIKey | XKWCQAJOQMFZFB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |