C11H13FN2O3 — CID 105382560
3-fluoro-2-[(2-methyloxolan-3-yl)amino]pyridine-4-carboxylic acid (PubChem CID 105382560) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-fluoro-2-[(2-methyloxolan-3-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-[(2-methyloxolan-3-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105382560 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-fluoro-2-[(2-methyloxolan-3-yl)amino]pyridine-4-carboxylic acid |
| SMILES | CC1OCCC1Nc1nccc(C(=O)O)c1F |
| InChI | InChI=1S/C11H13FN2O3/c1-6-8(3-5-17-6)14-10-9(12)7(11(15)16)2-4-13-10/h2,4,6,8H,3,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | NBHNOUOEDZHJMC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |