C11H11FN2O2 — CID 105382661
2-(cyclopent-3-en-1-ylamino)-3-fluoropyridine-4-carboxylic acid (PubChem CID 105382661) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-(cyclopent-3-en-1-ylamino)-3-fluoropyridine-4-carboxylic acid.
| Compound Name | 2-(cyclopent-3-en-1-ylamino)-3-fluoropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105382661 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-(cyclopent-3-en-1-ylamino)-3-fluoropyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NC2CC=CC2)c1F |
| InChI | InChI=1S/C11H11FN2O2/c12-9-8(11(15)16)5-6-13-10(9)14-7-3-1-2-4-7/h1-2,5-7H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | NWWXYNLFQIIHKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|