5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid

C9H12N2O3S — CID 82737354

IUPAC5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid
SMILESCC1OCCC1Nc1scnc1C(=O)O
InChIInChI=1S/C9H12N2O3S/c1-5-6(2-3-14-5)11-8-7(9(12)13)10-4-15-8/h4-6,11H,2-3H2,1H3,(H,12,13)
InChIKeyHGRJFQMVYVFTCE-UHFFFAOYSA-N
MW228.27 g/mol
LogP1.43
Rot. Bonds3

About 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid

5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 82737354) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid
PubChem CID82737354
Molecular FormulaC9H12N2O3S
Molecular Weight228.27 g/mol
Exact Mass228.06
IUPAC Name5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid
SMILESCC1OCCC1Nc1scnc1C(=O)O
InChIInChI=1S/C9H12N2O3S/c1-5-6(2-3-14-5)11-8-7(9(12)13)10-4-15-8/h4-6,11H,2-3H2,1H3,(H,12,13)
InChIKeyHGRJFQMVYVFTCE-UHFFFAOYSA-N
XLogP1.43
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.27
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid (CID 82737354) is 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid is CC1OCCC1Nc1scnc1C(=O)O.
What is the InChIKey of 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is HGRJFQMVYVFTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-5-6(2-3-14-5)11-8-7(9(12)13)10-4-15-8/h4-6,11H,2-3H2,1H3,(H,12,13).
What are the key properties of 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 228.27 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methyloxolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 82737354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).