About 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid
5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 107853950) has the molecular formula C13H12N2O2S
and a molecular weight of 260.32 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 107853950 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H12N2O2S/c16-13(17)11-12(18-7-14-11)15-10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10,15H,5-6H2,(H,16,17) |
| InChIKey | DYKFFMCSSWEPDE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid (CID 107853950) is 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1NC1Cc2ccccc2C1.
What is the InChIKey of 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is DYKFFMCSSWEPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S/c16-13(17)11-12(18-7-14-11)15-10-5-8-3-1-2-4-9(8)6-10/h1-4,7,10,15H,5-6H2,(H,16,17).
What are the key properties of 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid?
5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 260.32 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydro-1H-inden-2-ylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 107853950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).