C15H14N2O2 — CID 114009300
6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid (PubChem CID 114009300) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114009300 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NC2Cc3ccccc3C2)nc1 |
| InChI | InChI=1S/C15H14N2O2/c18-15(19)12-5-6-14(16-9-12)17-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,16,17)(H,18,19) |
| InChIKey | KLDSXJAQBKXDCQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |