6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid

C15H14N2O2 — CID 114009300

IUPAC6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(NC2Cc3ccccc3C2)nc1
InChIInChI=1S/C15H14N2O2/c18-15(19)12-5-6-14(16-9-12)17-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,16,17)(H,18,19)
InChIKeyKLDSXJAQBKXDCQ-UHFFFAOYSA-N
MW254.29 g/mol
LogP2.36
Rot. Bonds3

About 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid

6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid (PubChem CID 114009300) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid
PubChem CID114009300
Molecular FormulaC15H14N2O2
Molecular Weight254.29 g/mol
Exact Mass254.11
IUPAC Name6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(NC2Cc3ccccc3C2)nc1
InChIInChI=1S/C15H14N2O2/c18-15(19)12-5-6-14(16-9-12)17-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,16,17)(H,18,19)
InChIKeyKLDSXJAQBKXDCQ-UHFFFAOYSA-N
XLogP2.36
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 52.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid?
The IUPAC name of 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid (CID 114009300) is 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid?
The canonical SMILES for 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid is O=C(O)c1ccc(NC2Cc3ccccc3C2)nc1.
What is the InChIKey of 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid?
The InChIKey is KLDSXJAQBKXDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c18-15(19)12-5-6-14(16-9-12)17-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,16,17)(H,18,19).
What are the key properties of 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid?
6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid has a molecular weight of 254.29 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxylic acid is sourced from PubChem (CID 114009300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).