C12H17N3O2 — CID 61404521
6-[3-(cyclopropylamino)propylamino]pyridine-3-carboxylic acid (PubChem CID 61404521) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-[3-(cyclopropylamino)propylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[3-(cyclopropylamino)propylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61404521 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-[3-(cyclopropylamino)propylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCCCNC2CC2)nc1 |
| InChI | InChI=1S/C12H17N3O2/c16-12(17)9-2-5-11(15-8-9)14-7-1-6-13-10-3-4-10/h2,5,8,10,13H,1,3-4,6-7H2,(H,14,15)(H,16,17) |
| InChIKey | NYPNIRHMTCPNID-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|