C12H19N3O — CID 106504375
N-cyclopropyl-N'-(5-methoxy-2-pyridinyl)propane-1,3-diamine (PubChem CID 106504375) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-cyclopropyl-N'-(5-methoxy-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-(5-methoxy-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 106504375 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-cyclopropyl-N'-(5-methoxy-2-pyridinyl)propane-1,3-diamine |
| SMILES | COc1ccc(NCCCNC2CC2)nc1 |
| InChI | InChI=1S/C12H19N3O/c1-16-11-5-6-12(15-9-11)14-8-2-7-13-10-3-4-10/h5-6,9-10,13H,2-4,7-8H2,1H3,(H,14,15) |
| InChIKey | NEBAVTDWTFITBN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|