C15H16N2O3 — CID 82728278
2-[(2-methyloxolan-3-yl)amino]quinoline-5-carboxylic acid (PubChem CID 82728278) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[(2-methyloxolan-3-yl)amino]quinoline-5-carboxylic acid.
| Compound Name | 2-[(2-methyloxolan-3-yl)amino]quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 82728278 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(2-methyloxolan-3-yl)amino]quinoline-5-carboxylic acid |
| SMILES | CC1OCCC1Nc1ccc2c(C(=O)O)cccc2n1 |
| InChI | InChI=1S/C15H16N2O3/c1-9-12(7-8-20-9)16-14-6-5-10-11(15(18)19)3-2-4-13(10)17-14/h2-6,9,12H,7-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | WOFMRYFVLXYHJM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |