C13H17NO4S — CID 60708633
methyl 3-[(1,1-dioxothiolan-3-yl)amino]-4-methylbenzoate (PubChem CID 60708633) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 3-[(1,1-dioxothiolan-3-yl)amino]-4-methylbenzoate.
| Compound Name | methyl 3-[(1,1-dioxothiolan-3-yl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 60708633 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | methyl 3-[(1,1-dioxothiolan-3-yl)amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17NO4S/c1-9-3-4-10(13(15)18-2)7-12(9)14-11-5-6-19(16,17)8-11/h3-4,7,11,14H,5-6,8H2,1-2H3 |
| InChIKey | YCOPGFGVAUVHBA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |