C15H22N2O3S — CID 43734956
3-[(1,1-dioxothian-4-yl)amino]-N-ethyl-4-methylbenzamide (PubChem CID 43734956) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)amino]-N-ethyl-4-methylbenzamide.
| Compound Name | 3-[(1,1-dioxothian-4-yl)amino]-N-ethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 43734956 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)amino]-N-ethyl-4-methylbenzamide |
| SMILES | CCNC(=O)c1ccc(C)c(NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-3-16-15(18)12-5-4-11(2)14(10-12)17-13-6-8-21(19,20)9-7-13/h4-5,10,13,17H,3,6-9H2,1-2H3,(H,16,18) |
| InChIKey | BIAHJWHGWNJHRE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |