C16H24N2O — CID 43726864
3-(cycloheptylamino)-N,4-dimethylbenzamide (PubChem CID 43726864) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-(cycloheptylamino)-N,4-dimethylbenzamide.
| Compound Name | 3-(cycloheptylamino)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43726864 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-(cycloheptylamino)-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NC2CCCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O/c1-12-9-10-13(16(19)17-2)11-15(12)18-14-7-5-3-4-6-8-14/h9-11,14,18H,3-8H2,1-2H3,(H,17,19) |
| InChIKey | HKTUZLLXUHNBPU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |