C18H27N3O2 — CID 146143095
3-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-N,4-dimethylbenzamide (PubChem CID 146143095) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-N,4-dimethylbenzamide.
| Compound Name | 3-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 146143095 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NC(=O)[C@@H](N)CC2CCCCC2)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-12-8-9-14(17(22)20-2)11-16(12)21-18(23)15(19)10-13-6-4-3-5-7-13/h8-9,11,13,15H,3-7,10,19H2,1-2H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | AUDGJOUGPBPRJK-HNNXBMFYSA-N |
| XLogP | 2.59 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |