C14H21N3O3S — CID 82989589
3-amino-4-[(1,1-dioxothian-4-yl)amino]-N-ethylbenzamide (PubChem CID 82989589) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-amino-4-[(1,1-dioxothian-4-yl)amino]-N-ethylbenzamide.
| Compound Name | 3-amino-4-[(1,1-dioxothian-4-yl)amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 82989589 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-amino-4-[(1,1-dioxothian-4-yl)amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(NC2CCS(=O)(=O)CC2)c(N)c1 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-16-14(18)10-3-4-13(12(15)9-10)17-11-5-7-21(19,20)8-6-11/h3-4,9,11,17H,2,5-8,15H2,1H3,(H,16,18) |
| InChIKey | ZCIQOLDBOOIMON-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|