C13H17ClN2O3S — CID 63162774
4-chloro-3-[(1,1-dioxothiolan-3-yl)amino]-N,N-dimethylbenzamide (PubChem CID 63162774) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 4-chloro-3-[(1,1-dioxothiolan-3-yl)amino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-3-[(1,1-dioxothiolan-3-yl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 63162774 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-chloro-3-[(1,1-dioxothiolan-3-yl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17ClN2O3S/c1-16(2)13(17)9-3-4-11(14)12(7-9)15-10-5-6-20(18,19)8-10/h3-4,7,10,15H,5-6,8H2,1-2H3 |
| InChIKey | FLFGUARXQFFBHS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |