C16H20BrF2N — CID 114817235
N-(2-bromo-4,6-difluorophenyl)spiro[4.5]decan-8-amine (PubChem CID 114817235) has the molecular formula C16H20BrF2N and a molecular weight of 344.24 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)spiro[4.5]decan-8-amine.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)spiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 114817235 |
| Molecular Formula | C16H20BrF2N |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)spiro[4.5]decan-8-amine |
| SMILES | Fc1cc(F)c(NC2CCC3(CCCC3)CC2)c(Br)c1 |
| InChI | InChI=1S/C16H20BrF2N/c17-13-9-11(18)10-14(19)15(13)20-12-3-7-16(8-4-12)5-1-2-6-16/h9-10,12,20H,1-8H2 |
| InChIKey | BTYPIGAIPZXINU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |