C17H23BrF2N2O2 — CID 113247870
tert-butyl N-[3-(2-bromo-4,6-difluoroanilino)cyclohexyl]carbamate (PubChem CID 113247870) has the molecular formula C17H23BrF2N2O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is tert-butyl N-[3-(2-bromo-4,6-difluoroanilino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-bromo-4,6-difluoroanilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 113247870 |
| Molecular Formula | C17H23BrF2N2O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | tert-butyl N-[3-(2-bromo-4,6-difluoroanilino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(Nc2c(F)cc(F)cc2Br)C1 |
| InChI | InChI=1S/C17H23BrF2N2O2/c1-17(2,3)24-16(23)22-12-6-4-5-11(9-12)21-15-13(18)7-10(19)8-14(15)20/h7-8,11-12,21H,4-6,9H2,1-3H3,(H,22,23) |
| InChIKey | SSMSGQAOPJLYPX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |