C15H19Br3N2O2 — CID 103759372
tert-butyl N-[3-(2,4,6-tribromoanilino)cyclobutyl]carbamate (PubChem CID 103759372) has the molecular formula C15H19Br3N2O2 and a molecular weight of 499.04 g/mol. Its IUPAC name is tert-butyl N-[3-(2,4,6-tribromoanilino)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,4,6-tribromoanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103759372 |
| Molecular Formula | C15H19Br3N2O2 |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 495.90 |
| IUPAC Name | tert-butyl N-[3-(2,4,6-tribromoanilino)cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Nc2c(Br)cc(Br)cc2Br)C1 |
| InChI | InChI=1S/C15H19Br3N2O2/c1-15(2,3)22-14(21)20-10-6-9(7-10)19-13-11(17)4-8(16)5-12(13)18/h4-5,9-10,19H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | HTXVPIVVORDWPE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |