C12H13FN2O2S — CID 55160660
3-[(1,1-dioxothiolan-3-yl)amino]-5-fluoro-4-methylbenzonitrile (PubChem CID 55160660) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)amino]-5-fluoro-4-methylbenzonitrile.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)amino]-5-fluoro-4-methylbenzonitrile |
|---|---|
| PubChem CID | 55160660 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)amino]-5-fluoro-4-methylbenzonitrile |
| SMILES | Cc1c(F)cc(C#N)cc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13FN2O2S/c1-8-11(13)4-9(6-14)5-12(8)15-10-2-3-18(16,17)7-10/h4-5,10,15H,2-3,7H2,1H3 |
| InChIKey | JDJKVQDHIXCXIM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |