C16H22N4O6 — CID 133342332
1-tert-butyl-4-[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]pyrrolidin-2-one (PubChem CID 133342332) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]pyrrolidin-2-one.
| Compound Name | 1-tert-butyl-4-[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 133342332 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-tert-butyl-4-[4-(hydroxymethyl)-3-methyl-2,6-dinitroanilino]pyrrolidin-2-one |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(NC2CC(=O)N(C(C)(C)C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O6/c1-9-10(8-21)5-12(19(23)24)14(15(9)20(25)26)17-11-6-13(22)18(7-11)16(2,3)4/h5,11,17,21H,6-8H2,1-4H3 |
| InChIKey | UDXRHFVFOZDKMP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|