C16H20ClN3O5 — CID 133368534
methyl 4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-2-chloro-5-nitrobenzoate (PubChem CID 133368534) has the molecular formula C16H20ClN3O5 and a molecular weight of 369.81 g/mol. Its IUPAC name is methyl 4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-2-chloro-5-nitrobenzoate.
| Compound Name | methyl 4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 133368534 |
| Molecular Formula | C16H20ClN3O5 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | methyl 4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]-2-chloro-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(NC2CC(=O)N(C(C)(C)C)C2)cc1Cl |
| InChI | InChI=1S/C16H20ClN3O5/c1-16(2,3)19-8-9(5-14(19)21)18-12-7-11(17)10(15(22)25-4)6-13(12)20(23)24/h6-7,9,18H,5,8H2,1-4H3 |
| InChIKey | YRRLAWWKQSXMQJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|