C19H22BrN3O3 — CID 133342289
methyl 6-bromo-4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]quinoline-2-carboxylate (PubChem CID 133342289) has the molecular formula C19H22BrN3O3 and a molecular weight of 420.31 g/mol. Its IUPAC name is methyl 6-bromo-4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]quinoline-2-carboxylate.
| Compound Name | methyl 6-bromo-4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 133342289 |
| Molecular Formula | C19H22BrN3O3 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | methyl 6-bromo-4-[(1-tert-butyl-5-oxopyrrolidin-3-yl)amino]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(NC2CC(=O)N(C(C)(C)C)C2)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C19H22BrN3O3/c1-19(2,3)23-10-12(8-17(23)24)21-15-9-16(18(25)26-4)22-14-6-5-11(20)7-13(14)15/h5-7,9,12H,8,10H2,1-4H3,(H,21,22) |
| InChIKey | XWQNECLBYOYDHV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |