C16H17BrN2O4 — CID 133399159
methyl 6-bromo-4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]quinoline-2-carboxylate (PubChem CID 133399159) has the molecular formula C16H17BrN2O4 and a molecular weight of 381.23 g/mol. Its IUPAC name is methyl 6-bromo-4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]quinoline-2-carboxylate.
| Compound Name | methyl 6-bromo-4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 133399159 |
| Molecular Formula | C16H17BrN2O4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | methyl 6-bromo-4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(NCC2(CO)COC2)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C16H17BrN2O4/c1-22-15(21)14-5-13(18-6-16(7-20)8-23-9-16)11-4-10(17)2-3-12(11)19-14/h2-5,20H,6-9H2,1H3,(H,18,19) |
| InChIKey | UNNGBFTZTHSFQN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |