C14H15BrN2O3 — CID 133381470
methyl 6-bromo-4-[2-hydroxyethyl(methyl)amino]quinoline-2-carboxylate (PubChem CID 133381470) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is methyl 6-bromo-4-[2-hydroxyethyl(methyl)amino]quinoline-2-carboxylate.
| Compound Name | methyl 6-bromo-4-[2-hydroxyethyl(methyl)amino]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 133381470 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | methyl 6-bromo-4-[2-hydroxyethyl(methyl)amino]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(N(C)CCO)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-17(5-6-18)13-8-12(14(19)20-2)16-11-4-3-9(15)7-10(11)13/h3-4,7-8,18H,5-6H2,1-2H3 |
| InChIKey | KIYQUOKJNWALLO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |