C21H26BrN3O2 — CID 133317795
methyl 6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinoline-2-carboxylate (PubChem CID 133317795) has the molecular formula C21H26BrN3O2 and a molecular weight of 432.36 g/mol. Its IUPAC name is methyl 6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinoline-2-carboxylate.
| Compound Name | methyl 6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 133317795 |
| Molecular Formula | C21H26BrN3O2 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | methyl 6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(N2CCC(CN3CCCC3)CC2)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C21H26BrN3O2/c1-27-21(26)19-13-20(17-12-16(22)4-5-18(17)23-19)25-10-6-15(7-11-25)14-24-8-2-3-9-24/h4-5,12-13,15H,2-3,6-11,14H2,1H3 |
| InChIKey | GVRKSKOFAGDKHF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |