C19H22BrN3O2 — CID 133320083
methyl 6-bromo-4-[(1-prop-2-enylpiperidin-4-yl)amino]quinoline-2-carboxylate (PubChem CID 133320083) has the molecular formula C19H22BrN3O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is methyl 6-bromo-4-[(1-prop-2-enylpiperidin-4-yl)amino]quinoline-2-carboxylate.
| Compound Name | methyl 6-bromo-4-[(1-prop-2-enylpiperidin-4-yl)amino]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 133320083 |
| Molecular Formula | C19H22BrN3O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | methyl 6-bromo-4-[(1-prop-2-enylpiperidin-4-yl)amino]quinoline-2-carboxylate |
| SMILES | C=CCN1CCC(Nc2cc(C(=O)OC)nc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C19H22BrN3O2/c1-3-8-23-9-6-14(7-10-23)21-17-12-18(19(24)25-2)22-16-5-4-13(20)11-15(16)17/h3-5,11-12,14H,1,6-10H2,2H3,(H,21,22) |
| InChIKey | UIYROBROLCDUNI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|