C20H23N3O5 — CID 133286669
[2-methyl-3,5-dinitro-4-(4-phenylazepan-1-yl)phenyl]methanol (PubChem CID 133286669) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is [2-methyl-3,5-dinitro-4-(4-phenylazepan-1-yl)phenyl]methanol.
| Compound Name | [2-methyl-3,5-dinitro-4-(4-phenylazepan-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 133286669 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [2-methyl-3,5-dinitro-4-(4-phenylazepan-1-yl)phenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(N2CCCC(c3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N3O5/c1-14-17(13-24)12-18(22(25)26)20(19(14)23(27)28)21-10-5-8-16(9-11-21)15-6-3-2-4-7-15/h2-4,6-7,12,16,24H,5,8-11,13H2,1H3 |
| InChIKey | RJOPCRXPHYLYLV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|