C21H22N4O5S — CID 133393594
2-(1H-indol-3-yl)-1-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 133393594) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 133393594 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[4-(3-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | CS(=O)(=O)c1cccc(N2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N4O5S/c1-31(29,30)19-8-4-7-18(21(19)25(27)28)23-9-11-24(12-10-23)20(26)13-15-14-22-17-6-3-2-5-16(15)17/h2-8,14,22H,9-13H2,1H3 |
| InChIKey | PBPMTOCCFSIUOL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|