C24H30N4O — CID 109002291
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[2-(1H-indol-3-yl)ethylamino]ethanone (PubChem CID 109002291) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[2-(1H-indol-3-yl)ethylamino]ethanone.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[2-(1H-indol-3-yl)ethylamino]ethanone |
|---|---|
| PubChem CID | 109002291 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-[2-(1H-indol-3-yl)ethylamino]ethanone |
| SMILES | Cc1cccc(N2CCN(C(=O)CNCCc3c[nH]c4ccccc34)CC2)c1C |
| InChI | InChI=1S/C24H30N4O/c1-18-6-5-9-23(19(18)2)27-12-14-28(15-13-27)24(29)17-25-11-10-20-16-26-22-8-4-3-7-21(20)22/h3-9,16,25-26H,10-15,17H2,1-2H3 |
| InChIKey | XFWFGWAFDZZTBC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|